Compound Q&A

Is (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4) safe?

Answer

(2-Fluoro-3-methoxyphenyl)boronic acid
(2-Fluoro-3-methoxyphenyl)boronic acid is generally considered safe for most laboratory use when proper handling guidelines are followed. However, it should be handled with care due to its reactive nature. Wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Ensure adequate ventilation and avoid inhalation or contact with skin and eyes. Follow all safety standards and protocols.

About

English Name (2-Fluoro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.95 g/mol
SMILES B(C1=C(C(=CC=C1)OC)F)(O)O
InChIKey JCKZNMSBFBPDPM-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What is (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4)?

(2-Fluoro-3-methoxyphenyl)boronic acid is a compound with the chemical formula C9H9FO3B. It is an or...

Compound Q&A

What are the main uses of (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4)?

(2-Fluoro-3-methoxyphenyl)boronic acid is primarily used in the synthesis of various organic compoun...

Compound Q&A

How should (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4) be stored?

(2-Fluoro-3-methoxyphenyl)boronic acid should be stored in a cool, dry place away from direct sunlig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...