Compound Q&A

What are the main uses of 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1)?

Answer

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid
2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is primarily used in the pharmaceutical industry for the synthesis of other active pharmaceutical ingredients (APIs). It also has applications in research for its unique chemical properties, and in some industrial processes for specialized applications.

About

CAS No 599-79-1
English Name 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid
Molecular Formula C18H14N4O5S
Molecular Weight 398.4 g/mol
SMILES OC(=O)c1cc(N=Nc2ccc(cc2)S(=O)(=O)Nc3ccccn3)ccc1O
InChIKey NCEXYHBECQHGNR-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What is 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1)?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is a chemical compound with the CAS numbe...

Compound Q&A

Is 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1) safe?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is considered to have a low to moderate t...

Compound Q&A

How should 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1) be stored?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid should be stored in tightly sealed contai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...