Compound Q&A

What is 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1)?

Answer

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid
2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is a chemical compound with the CAS number 599-79-1. It is a white crystalline powder with a molecular weight of approximately 412.34. This compound is characterized by its aromatic structure with a hydroxyl group and a sulfamoyl group, making it a complex organic molecule with potential applications in various fields.

About

CAS No 599-79-1
English Name 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid
Molecular Formula C18H14N4O5S
Molecular Weight 398.4 g/mol
SMILES OC(=O)c1cc(N=Nc2ccc(cc2)S(=O)(=O)Nc3ccccn3)ccc1O
InChIKey NCEXYHBECQHGNR-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What are the main uses of 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1)?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is primarily used in the pharmaceutical i...

Compound Q&A

Is 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1) safe?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid is considered to have a low to moderate t...

Compound Q&A

How should 2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid (CAS: 599-79-1) be stored?

2-hydroxy-5-[4-(2-pyridylsulfamoyl)phenyl]azo-benzoic acid should be stored in tightly sealed contai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...