Compound Q&A

How should 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1) be stored?

Answer

1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid
Store this compound in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly sealed container to prevent degradation. Avoid contact with moisture and maintain a stable temperature between 15-25°C to ensure optimal stability and safety.

About

English Name 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)NC1(CCC1)C(=O)O
InChIKey ROVVUKFHORPDSM-UHFFFAOYSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What is 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1)?

1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid is a chemical compound chara...

Compound Q&A

What are the main uses of 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1)?

This compound is mainly used in the pharmaceutical industry as a precursor for drug synthesis. Addit...

Compound Q&A

Is 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1) safe?

While generally safe under controlled conditions, this compound should be handled with care due to i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...