Compound Q&A

What is 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1)?

Answer

1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid
1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid is a chemical compound characterized by its cyclic structure and amino group. It has the chemical formula C8H14NO4. This compound is often used in pharmaceutical applications for its biological activity.

About

English Name 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)NC1(CCC1)C(=O)O
InChIKey ROVVUKFHORPDSM-UHFFFAOYSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1)?

This compound is mainly used in the pharmaceutical industry as a precursor for drug synthesis. Addit...

Compound Q&A

Is 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1) safe?

While generally safe under controlled conditions, this compound should be handled with care due to i...

Compound Q&A

How should 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid (CAS: 120728-10-1) be stored?

Store this compound in a cool, dry place away from direct sunlight and heat sources. Keep it in a ti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...