Compound Q&A

How should 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4) be stored?

Answer

5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
This compound should be stored in a cool, dry place, ideally at room temperature (15-25°C) and away from direct sunlight. It should be kept in a tightly sealed container to protect it from moisture and light. Avoid contact with incompatible materials, such as strong acids or bases, to prevent degradation or hazardous reactions.

About

CAS No 20126-59-4
English Name 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Molecular Formula C22H22O11
Molecular Weight 462.41 g/mol
SMILES COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O
InChIKey WKUHPOMCLBLCOV-MIUGBVLSSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What is 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4)?

5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside is a complex or...

Compound Q&A

What are the main uses of 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4)?

This compound is primarily used in pharmaceuticals, specifically as an active ingredient in drugs ta...

Compound Q&A

Is 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4) safe?

The compound is generally considered safe for its intended uses. However, like any chemical, it shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...