Compound Q&A

What is 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4)?

Answer

5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside is a complex organic compound with a chromen-core structure and a glucose moiety attached. It is characterized by its hydroxy and methoxy functional groups, making it versatile for various applications. Its chemical formula is C23H24O11.

About

CAS No 20126-59-4
English Name 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Molecular Formula C22H22O11
Molecular Weight 462.41 g/mol
SMILES COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O
InChIKey WKUHPOMCLBLCOV-MIUGBVLSSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4)?

This compound is primarily used in pharmaceuticals, specifically as an active ingredient in drugs ta...

Compound Q&A

Is 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4) safe?

The compound is generally considered safe for its intended uses. However, like any chemical, it shou...

Compound Q&A

How should 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 20126-59-4) be stored?

This compound should be stored in a cool, dry place, ideally at room temperature (15-25°C) and away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...