Related Q&A
What is O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7)?
O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate is a chemical compound with the CAS num...
What are the main uses of O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7)?
This compound is primarily used in research and development for its unique chemical properties, whic...
Is O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7) safe?
While this compound is not inherently toxic, it should be handled with caution due to its chemical n...
What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?
6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...
What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...
What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?
2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...
What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?
2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...




