Related Q&A
What are the main uses of O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7)?
This compound is primarily used in research and development for its unique chemical properties, whic...
Is O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7) safe?
While this compound is not inherently toxic, it should be handled with caution due to its chemical n...
How should O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate (CAS: 41198-08-7) be stored?
Store this compound in a cool, dry place away from direct sunlight and heat sources. Use a sealed co...
How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?
2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...
Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?
(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...
What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?
(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...
What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?
2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...




