Compound Q&A

How should Thiazole yellow G (CAS: 1829-00-1) be stored?

Answer

Thiazole yellow G
Thiazole yellow G (CAS: 1829-00-1) should be stored in a cool, dry, and well-ventilated area, away from direct sunlight and heat sources. Keep it in a tightly sealed container to prevent moisture and contamination. The storage temperature should ideally be maintained between 15-25°C. Avoid storing it near incompatible materials such as reducing agents or strong acids to ensure safety and stability.

About

CAS No 1829-00-1
English Name Thiazole yellow G
Molecular Formula C28H19N5Na2O6S4
Molecular Weight 695.72 g/mol
SMILES Cc1ccc2c(c1S(=O)(=O)[O-])sc(n2)c1ccc(cc1)NN=Nc1ccc(cc1)c1nc2c(s1)c(c(cc2)C)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey CZIRZNRQHFVCDZ-UHFFFAOYSA-L
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is Thiazole yellow G (CAS: 1829-00-1)?

Thiazole yellow G is a synthetic organic compound with the CAS number 1829-00-1. It is a yellow azo ...

Compound Q&A

What are the main uses of Thiazole yellow G (CAS: 1829-00-1)?

Thiazole yellow G (CAS: 1829-00-1) is primarily used as a food dye, providing a vivid yellow color t...

Compound Q&A

Is Thiazole yellow G (CAS: 1829-00-1) safe?

Thiazole yellow G is generally considered safe for food use and is approved by regulatory bodies lik...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...