Compound Q&A

What are the main uses of beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9)?

Answer

beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (1:2)
This compound is primarily used in research and pharmaceutical applications. It may serve as a precursor or intermediate in the synthesis of other compounds, and it can also be used in targeted drug delivery systems or as an investigational drug due to its unique chemical properties.

About

English Name beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (1:2)
Molecular Formula C23H37N5O7
Molecular Weight 435.53 g/mol
SMILES CC(O)=O.O=C([C@H]1N(C(CCN)=O)CCC1)N[C@@H](CCN)C(NCC2=CC=CC=C2)=O
InChIKey HSUGRPOJOBRRBK-SXBSVMRRSA-N
Last Updated: 2025-08-29 23:06

Related Q&A

Compound Q&A

What is beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9)?

Beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate is a complex orga...

Compound Q&A

Is beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9) safe?

While the compound is generally safe under normal handling conditions, it should be used with cautio...

Compound Q&A

How should beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...