Compound Q&A

What is beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9)?

Answer

beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (1:2)
Beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate is a complex organic compound with a unique chemical structure. It is composed of amino acids and has a molecular formula that reflects its complexity. This compound is typically used in specialized research and pharmaceutical applications due to its unique properties.

About

English Name beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (1:2)
Molecular Formula C23H37N5O7
Molecular Weight 435.53 g/mol
SMILES CC(O)=O.O=C([C@H]1N(C(CCN)=O)CCC1)N[C@@H](CCN)C(NCC2=CC=CC=C2)=O
InChIKey HSUGRPOJOBRRBK-SXBSVMRRSA-N
Last Updated: 2025-08-29 23:06

Related Q&A

Compound Q&A

What are the main uses of beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9)?

This compound is primarily used in research and pharmaceutical applications. It may serve as a precu...

Compound Q&A

Is beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9) safe?

While the compound is generally safe under normal handling conditions, it should be used with cautio...

Compound Q&A

How should beta-Alanyl-N-[(2S)-4-amino-1-(benzylamino)-1-oxo-2-butanyl]-L-prolinamide acetate (CAS: 823202-99-9) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...