Compound Q&A

What are the main uses of 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5)?

Answer

3-Methyl-6-nitro-1H-indazole
3-Methyl-6-nitro-1H-indazole is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also utilized in research for its chemical reactivity and stability. Additionally, it has potential applications in the development of dyes and pigments.

About

CAS No 6494-19-5
English Name 3-Methyl-6-nitro-1H-indazole
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES CC1=C2C=CC(=CC2=NN1)[N+](=O)[O-]
InChIKey FUNWSYKLFDLUIZ-UHFFFAOYSA-N
Last Updated: 2025-08-29 23:06

Related Q&A

Compound Q&A

What is 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5)?

3-Methyl-6-nitro-1H-indazole is a heterocyclic compound. Its chemical formula is C10H7N2O2. This com...

Compound Q&A

Is 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5) safe?

3-Methyl-6-nitro-1H-indazole is generally considered safe when handled properly. However, it is impo...

Compound Q&A

How should 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5) be stored?

3-Methyl-6-nitro-1H-indazole should be stored in a cool, dry place away from direct sunlight and sou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...