Compound Q&A

What is 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5)?

Answer

3-Methyl-6-nitro-1H-indazole
3-Methyl-6-nitro-1H-indazole is a heterocyclic compound. Its chemical formula is C10H7N2O2. This compound has a distinctive molecular structure that includes a five-membered ring with a methyl substitution at the 3-position and a nitro group at the 6-position. It is often used in pharmaceuticals and research due to its unique chemical properties.

About

CAS No 6494-19-5
English Name 3-Methyl-6-nitro-1H-indazole
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES CC1=C2C=CC(=CC2=NN1)[N+](=O)[O-]
InChIKey FUNWSYKLFDLUIZ-UHFFFAOYSA-N
Last Updated: 2025-08-29 23:06

Related Q&A

Compound Q&A

What are the main uses of 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5)?

3-Methyl-6-nitro-1H-indazole is primarily used in the pharmaceutical industry for the synthesis of v...

Compound Q&A

Is 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5) safe?

3-Methyl-6-nitro-1H-indazole is generally considered safe when handled properly. However, it is impo...

Compound Q&A

How should 3-Methyl-6-nitro-1H-indazole (CAS: 6494-19-5) be stored?

3-Methyl-6-nitro-1H-indazole should be stored in a cool, dry place away from direct sunlight and sou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...