Compound Q&A

Is 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) safe?

Answer

3,6-Diamino-10-methylacridinium chloride 3,6-acridinediamine (1:1:1)
3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) requires careful handling due to potential toxicity. It may cause skin and eye irritation, so protective gloves, goggles, and ventilation are recommended. Safety standards emphasize adherence to OSHA and CDC guidelines, and it should be stored away from incompatible materials. Always consult safety data sheets (SDS) for proper handling procedures.

About

CAS No 8048-52-0
English Name 3,6-Diamino-10-methylacridinium chloride 3,6-acridinediamine (1:1:1)
Molecular Formula C27H25ClN6
Molecular Weight 469 g/mol
SMILES C[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N.[Cl-]
InChIKey PEJLNXHANOHNSU-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0)?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) is a heterocyclic compound with the chemic...

Compound Q&A

What are the main uses of 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0)?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) is primarily used in pharmaceutical resear...

Compound Q&A

How should 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) be stored?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) should be stored in a cool, dry place, pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...