Compound Q&A

What are the main uses of 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0)?

Answer

3,6-Diamino-10-methylacridinium chloride 3,6-acridinediamine (1:1:1)
3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) is primarily used in pharmaceutical research as a fluorescent probe and in organic synthesis as a building block. It also finds applications in industrial dye production and as a precursor for developing antiseptic and antifungal agents. Its unique chemical structure makes it valuable in biochemical studies and for labeling purposes in analytical techniques.

About

CAS No 8048-52-0
English Name 3,6-Diamino-10-methylacridinium chloride 3,6-acridinediamine (1:1:1)
Molecular Formula C27H25ClN6
Molecular Weight 469 g/mol
SMILES C[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N.[Cl-]
InChIKey PEJLNXHANOHNSU-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0)?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) is a heterocyclic compound with the chemic...

Compound Q&A

Is 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) safe?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) requires careful handling due to potential...

Compound Q&A

How should 3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) be stored?

3,6-Diamino-10-methylacridinium chloride (CAS: 8048-52-0) should be stored in a cool, dry place, pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...