Compound Q&A

What are the main uses of (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1)?

Answer

(S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride
This compound (CAS: 898543-06-1) is primarily utilized in pharmaceutical research as an intermediate for drug development, particularly in the synthesis of bioactive molecules. Its structure may be relevant in creating compounds with antimicrobial, antiviral, or anti-inflammatory properties. It is also employed in chemical synthesis and industrial applications where functional group versatility is required. Additionally, it serves as a research tool for studying molecular interactions and reaction mechanisms.

About

English Name (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride
Molecular Formula C14H18ClN3O4
Molecular Weight 327.77 g/mol
SMILES C1COCC(=O)N1C2=CC=C(C=C2)N3CC(OC3=O)CN.Cl
InChIKey ITMQDYQHNKXERQ-YDALLXLXSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1)?

This chemical compound (CAS: 898543-06-1) is a morpholinone derivative featuring a complex structure...

Compound Q&A

Is (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1) safe?

Safety of this compound (CAS: 898543-06-1) depends on proper handling. As a chemical compound, it ma...

Compound Q&A

How should (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1) be stored?

This compound (CAS: 898543-06-1) should be stored in a cool, dry place, ideally at 2-8°C, to maintai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...