Compound Q&A

What is (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1)?

Answer

(S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride
This chemical compound (CAS: 898543-06-1) is a morpholinone derivative featuring a complex structure with an aminomethyl group and an oxazolidinone ring. It is a hydrochloride salt, which enhances its solubility and stability. The compound is commonly used in pharmaceutical research and synthesis due to its functional groups, which may participate in various chemical reactions. Its molecular formula is C17H21N3O4·HCl, and it exhibits properties typical of nitrogen-containing heterocyclic compounds, such as reactivity and potential biological activity.

About

English Name (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride
Molecular Formula C14H18ClN3O4
Molecular Weight 327.77 g/mol
SMILES C1COCC(=O)N1C2=CC=C(C=C2)N3CC(OC3=O)CN.Cl
InChIKey ITMQDYQHNKXERQ-YDALLXLXSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1)?

This compound (CAS: 898543-06-1) is primarily utilized in pharmaceutical research as an intermediate...

Compound Q&A

Is (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1) safe?

Safety of this compound (CAS: 898543-06-1) depends on proper handling. As a chemical compound, it ma...

Compound Q&A

How should (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one hydrochloride (CAS: 898543-06-1) be stored?

This compound (CAS: 898543-06-1) should be stored in a cool, dry place, ideally at 2-8°C, to maintai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...