Compound Q&A

What are the main uses of N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8)?

Answer

N~6~-(Trifluoroacetyl)-L-lysine
N~6~-(Trifluoroacetyl)-L-lysine is primarily used in pharmaceutical research for the development of drugs and as a building block in the synthesis of bioactive compounds. It also finds applications in organic chemistry for creating derivatives with tailored functional properties. Additionally, it is used in chemical research and industrial processes due to its reactivity and stability, contributing to the creation of specialized materials and compounds.

About

CAS No 10009-20-8
English Name N~6~-(Trifluoroacetyl)-L-lysine
Molecular Formula C8H13F3N2O3
Molecular Weight 242.2 g/mol
SMILES C(CCNC(=O)C(F)(F)F)CC(C(=O)O)N
InChIKey PZZHRSVBHRVIMI-YFKPBYRVSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What is N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8)?

N~6~-(Trifluoroacetyl)-L-lysine is a chemical compound with the CAS number 10009-20-8. It is an acet...

Compound Q&A

Is N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8) safe?

N~6~-(Trifluoroacetyl)-L-lysine is generally considered safe when handled properly, but it requires ...

Compound Q&A

How should N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8) be stored?

N~6~-(Trifluoroacetyl)-L-lysine should be stored in a cool, dry, and dark place to maintain its stab...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...