Compound Q&A

What is N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8)?

Answer

N~6~-(Trifluoroacetyl)-L-lysine
N~6~-(Trifluoroacetyl)-L-lysine is a chemical compound with the CAS number 10009-20-8. It is an acetylated derivative of L-lysine, where the acetyl group is replaced by a trifluoroacetyl group. This compound is known for its unique chemical properties, including enhanced stability and reactivity, making it valuable in various scientific applications. It is typically used as an intermediate in organic synthesis and has a molecular formula of C10H12F3NO3.

About

CAS No 10009-20-8
English Name N~6~-(Trifluoroacetyl)-L-lysine
Molecular Formula C8H13F3N2O3
Molecular Weight 242.2 g/mol
SMILES C(CCNC(=O)C(F)(F)F)CC(C(=O)O)N
InChIKey PZZHRSVBHRVIMI-YFKPBYRVSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What are the main uses of N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8)?

N~6~-(Trifluoroacetyl)-L-lysine is primarily used in pharmaceutical research for the development of ...

Compound Q&A

Is N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8) safe?

N~6~-(Trifluoroacetyl)-L-lysine is generally considered safe when handled properly, but it requires ...

Compound Q&A

How should N~6~-(Trifluoroacetyl)-L-lysine (CAS: 10009-20-8) be stored?

N~6~-(Trifluoroacetyl)-L-lysine should be stored in a cool, dry, and dark place to maintain its stab...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...