Compound Q&A

What are the main uses of (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8)?

Answer

(1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile
This compound is primarily used in pharmaceutical research for its potential therapeutic properties. It may serve as a precursor in the development of drugs targeting neurological or metabolic disorders. Due to its complex structure, it is also studied for its chemical reactivity and role in synthetic pathways, particularly in drug synthesis and medicinal chemistry applications.

About

English Name (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile
Molecular Formula C18H25N3O2
Molecular Weight 315.4 g/mol
SMILES C1C2CC2N(C1C#N)C(=O)C(C34CC5CC(C3)CC(C5)(C4)O)N
InChIKey QGJUIPDUBHWZPV-YQBUGCKMSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What is (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8)?

This compound, with the CAS number 361442-04-8, is a complex organic molecule characterized by its b...

Compound Q&A

Is (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile ( CAS: 361442-04-8) safe?

Safety data for this compound is limited, but it is generally considered to have moderate toxicity b...

Compound Q&A

How should (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8) be stored?

This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...