Compound Q&A

What is (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8)?

Answer

(1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile
This compound, with the CAS number 361442-04-8, is a complex organic molecule characterized by its bicyclic structure and multiple functional groups. It contains a nitrile group, an amino group, and a substituted acetyl group, making it a potential candidate for pharmaceutical applications. Its molecular formula is C15H24N2O, and it is known for its stability under controlled conditions.

About

English Name (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile
Molecular Formula C18H25N3O2
Molecular Weight 315.4 g/mol
SMILES C1C2CC2N(C1C#N)C(=O)C(C34CC5CC(C3)CC(C5)(C4)O)N
InChIKey QGJUIPDUBHWZPV-YQBUGCKMSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What are the main uses of (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8)?

This compound is primarily used in pharmaceutical research for its potential therapeutic properties....

Compound Q&A

Is (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile ( CAS: 361442-04-8) safe?

Safety data for this compound is limited, but it is generally considered to have moderate toxicity b...

Compound Q&A

How should (1S,3S,5S)-2-{(2S)-2-Amino-2-[(1r,3R,5R,7S)-3-hydroxyadamantan-1-yl]acetyl}-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS: 361442-04-8) be stored?

This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...