Compound Q&A

What is N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1)?

Answer

N-(4-Aminobenzoyl)-L-glutamic acid
N-(4-Aminobenzoyl)-L-glutamic acid, with the CAS number 4271-30-1, is a synthetic compound commonly used in pharmaceutical research. It is a derivative of L-glutamic acid and contains an amino benzoyl group. This compound is known for its ability to act as a precursor in the synthesis of various drugs and is characterized by its acidic properties and potential for forming salts.

About

CAS No 4271-30-1
English Name N-(4-Aminobenzoyl)-L-glutamic acid
Molecular Formula C12H14N2O5
Molecular Weight 266.25 g/mol
SMILES C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)N
InChIKey GADGMZDHLQLZRI-VIFPVBQESA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1)?

N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1) is primarily used in pharmaceutical applications...

Compound Q&A

Is N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1) safe?

N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1) is generally considered safe when handled proper...

Compound Q&A

How should N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1) be stored?

N-(4-Aminobenzoyl)-L-glutamic acid (CAS: 4271-30-1) should be stored in a cool, dry, and dark place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...