Compound Q&A

What are the main uses of Bicalutamide Impurity 5 (CAS: 367-67-9)?

Answer

Bicalutamide Impurity 5
Bicalutamide Impurity 5 (CAS: 367-67-9) is primarily used in pharmaceutical research and quality control to identify and quantify impurities in bicalutamide formulations. It also serves as a reference standard in analytical chemistry for method validation and may be relevant in studying drug metabolism or degradation pathways in medicinal development.

About

CAS No 367-67-9
English Name Bicalutamide Impurity 5
Molecular Formula C7H3BrF3NO2
Molecular Weight 270 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)Br
InChIKey SXEQQBBOAMHOID-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Bicalutamide Impurity 5 (CAS: 367-67-9)?

Bicalutamide Impurity 5 (CAS: 367-67-9) is a chemical compound identified as a byproduct or degradat...

Compound Q&A

Is Bicalutamide Impurity 5 (CAS: 367-67-9) safe?

Bicalutamide Impurity 5 (CAS: 367-67-9) is generally considered safe in controlled laboratory settin...

Compound Q&A

How should Bicalutamide Impurity 5 (CAS: 367-67-9) be stored?

Bicalutamide Impurity 5 (CAS: 367-67-9) should be stored in a cool, dry place (ideally 2-8°C), prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...