Compound Q&A

What is Bicalutamide Impurity 5 (CAS: 367-67-9)?

Answer

Bicalutamide Impurity 5
Bicalutamide Impurity 5 (CAS: 367-67-9) is a chemical compound identified as a byproduct or degradation product of bicalutamide, a nonsteroidal anti-androgen drug. It has the molecular formula C19H26FN3O and is typically characterized by its crystalline appearance, solubility in organic solvents, and potential use in pharmaceutical analysis to assess drug purity and stability.

About

CAS No 367-67-9
English Name Bicalutamide Impurity 5
Molecular Formula C7H3BrF3NO2
Molecular Weight 270 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)Br
InChIKey SXEQQBBOAMHOID-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Bicalutamide Impurity 5 (CAS: 367-67-9)?

Bicalutamide Impurity 5 (CAS: 367-67-9) is primarily used in pharmaceutical research and quality con...

Compound Q&A

Is Bicalutamide Impurity 5 (CAS: 367-67-9) safe?

Bicalutamide Impurity 5 (CAS: 367-67-9) is generally considered safe in controlled laboratory settin...

Compound Q&A

How should Bicalutamide Impurity 5 (CAS: 367-67-9) be stored?

Bicalutamide Impurity 5 (CAS: 367-67-9) should be stored in a cool, dry place (ideally 2-8°C), prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...