Compound Q&A

What are the main uses of Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8)?

Answer

Methyl 4-amino-2-methoxybenzoate
Methyl 4-amino-2-methoxybenzoate is primarily used in pharmaceutical research as a building block for drug development. It also serves as an intermediate in the production of dyes and pigments. Additionally, it is employed in the synthesis of various organic compounds, including those used in agrochemicals and specialty chemicals. Its versatile structure makes it valuable in multiple industries, such as chemical manufacturing and research laboratories.

About

CAS No 27492-84-8
English Name Methyl 4-amino-2-methoxybenzoate
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES COC1=C(C=CC(=C1)N)C(=O)OC
InChIKey YUPQMVSYNJQULF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8)?

Methyl 4-amino-2-methoxybenzoate is an organic compound with the chemical formula C9H11NO3. It is a ...

Compound Q&A

Is Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8) safe?

Methyl 4-amino-2-methoxybenzoate is generally considered safe when handled properly. However, as wit...

Compound Q&A

How should Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8) be stored?

Methyl 4-amino-2-methoxybenzoate should be stored in a cool, dry, and well-ventilated area, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...