Compound Q&A

What is Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8)?

Answer

Methyl 4-amino-2-methoxybenzoate
Methyl 4-amino-2-methoxybenzoate is an organic compound with the chemical formula C9H11NO3. It is a white to off-white solid with a molecular weight of 177.19 g/mol. This compound is known for its aromatic structure and contains both amino and methoxy functional groups, making it useful in various chemical applications. It is commonly used as an intermediate in the synthesis of pharmaceutical compounds and dyes.

About

CAS No 27492-84-8
English Name Methyl 4-amino-2-methoxybenzoate
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES COC1=C(C=CC(=C1)N)C(=O)OC
InChIKey YUPQMVSYNJQULF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8)?

Methyl 4-amino-2-methoxybenzoate is primarily used in pharmaceutical research as a building block fo...

Compound Q&A

Is Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8) safe?

Methyl 4-amino-2-methoxybenzoate is generally considered safe when handled properly. However, as wit...

Compound Q&A

How should Methyl 4-amino-2-methoxybenzoate (CAS: 27492-84-8) be stored?

Methyl 4-amino-2-methoxybenzoate should be stored in a cool, dry, and well-ventilated area, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...