Compound Q&A

What are the main uses of 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3)?

Answer

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene
2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) is primarily used in pharmaceutical research as a potential lead compound for drug development. It may also find applications in organic synthesis and as an intermediate in the production of various chemical derivatives. Its unique structure makes it relevant for studying biological activity and molecular interactions.

About

English Name 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene
Molecular Formula C15H10BrFS
Molecular Weight 321.21 g/mol
SMILES Brc1ccc(c(c1)Cc1cc2c(s1)cccc2)F
InChIKey IKGTVOQAJKYBGO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3)?

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) is an organic compound that contains...

Compound Q&A

Is 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) safe?

The safety of 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) depends on its handlin...

Compound Q&A

How should 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) be stored?

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) should be stored in a cool, dry, and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...