Compound Q&A

What is 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3)?

Answer

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene
2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) is an organic compound that contains a benzothiophene ring substituted with a 5-bromo-2-fluorobenzyl group. It is known for its potential applications in medicinal chemistry and has a molecular formula of C17H13BrFOS. This compound exhibits specific physical and chemical properties, including solubility in organic solvents and stability under certain conditions.

About

English Name 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene
Molecular Formula C15H10BrFS
Molecular Weight 321.21399999999994 g/mol
SMILES Brc1ccc(c(c1)Cc1cc2c(s1)cccc2)F
InChIKey IKGTVOQAJKYBGO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3)?

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) is primarily used in pharmaceutical ...

Compound Q&A

Is 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) safe?

The safety of 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) depends on its handlin...

Compound Q&A

How should 2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) be stored?

2-(5-Bromo-2-fluorobenzyl)-1-benzothiophene (CAS: 1034305-17-3) should be stored in a cool, dry, and...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...