Compound Q&A

What are the main uses of Lapatinib Ditosylate (CAS: 388082-77-7)?

Answer

Lapatinib Ditosylate
Lapatinib Ditosylate (CAS: 388082-77-7) is primarily used in pharmaceuticals as a targeted therapy for HER2-positive breast cancer. It inhibits the growth of cancer cells by blocking specific protein receptors. Additionally, it is employed in research for studying kinase pathways and in drug development for creating cancer treatment options. Its applications are limited to medicinal and scientific fields due to its specialized chemical properties.

About

English Name Lapatinib Ditosylate
Molecular Formula C43H42ClFN4O10S3
Molecular Weight 925.5 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl
InChIKey UWYXLGUQQFPJRI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Lapatinib Ditosylate (CAS: 388082-77-7)?

Lapatinib Ditosylate (CAS: 388082-77-7) is a pharmaceutical compound used as a tyrosine kinase inhib...

Compound Q&A

Is Lapatinib Ditosylate (CAS: 388082-77-7) safe?

Lapatinib Ditosylate (CAS: 388082-77-7) is generally safe when used as directed in medical settings....

Compound Q&A

How should Lapatinib Ditosylate (CAS: 388082-77-7) be stored?

Lapatinib Ditosylate (CAS: 388082-77-7) should be stored in a cool, dry place at 2-8°C, protected fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...