Compound Q&A

How should 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) be stored?

Answer

1,4,5,8-Naphthalenetetracarboxylic acid
1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) should be stored in a cool, dry, and well-ventilated place, away from light. It is typically kept in airtight containers to prevent moisture absorption and degradation. Proper storage conditions include maintaining a temperature below 25°C and avoiding exposure to strong acids or bases to ensure stability and prolong shelf life.

About

CAS No 128-97-2
English Name 1,4,5,8-Naphthalenetetracarboxylic acid
Molecular Formula C14H8O8
Molecular Weight 304.21 g/mol
SMILES C1=CC(=C2C(=CC=C(C2=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey OLAPPGSPBNVTRF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2)?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is a polycyclic aromatic organic compound wi...

Compound Q&A

What are the main uses of 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2)?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is widely used in the synthesis of organic s...

Compound Q&A

Is 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) safe?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is generally considered safe when handled pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...