Compound Q&A

What is 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2)?

Answer

1,4,5,8-Naphthalenetetracarboxylic acid
1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is a polycyclic aromatic organic compound with the chemical formula C14H10O6. It is characterized by its four carboxylic acid groups attached to a naphthalene ring, making it a versatile building block in chemical synthesis. This compound is known for its high melting point and strong acidity, and it is commonly used in the production of organic materials and dyes.

About

CAS No 128-97-2
English Name 1,4,5,8-Naphthalenetetracarboxylic acid
Molecular Formula C14H8O8
Molecular Weight 304.21 g/mol
SMILES C1=CC(=C2C(=CC=C(C2=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey OLAPPGSPBNVTRF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2)?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is widely used in the synthesis of organic s...

Compound Q&A

Is 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) safe?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) is generally considered safe when handled pr...

Compound Q&A

How should 1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) be stored?

1,4,5,8-Naphthalenetetracarboxylic acid (CAS: 128-97-2) should be stored in a cool, dry, and well-ve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...