Compound Q&A

What are the main uses of 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7)?

Answer

2-Bromo-9,9'-spirobi[fluorene]
2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is primarily used in pharmaceutical research and organic electronics. Its unique molecular structure makes it a valuable compound for developing new materials with specific optical and electronic properties. It also finds applications in chemical synthesis as a precursor for other functional molecules.

About

English Name 2-Bromo-9,9'-spirobi[fluorene]
Molecular Formula C25H15Br
Molecular Weight 395.3 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)Br
InChIKey ONCCVJKFWKAZAE-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7)?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is an organic compound characterized by a spirobi[...

Compound Q&A

Is 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) safe?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is generally considered safe when handled properly...

Compound Q&A

How should 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) be stored?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) should be stored in a cool, dry, and dark place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...