Compound Q&A

What is 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7)?

Answer

2-Bromo-9,9'-spirobi[fluorene]
2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is an organic compound characterized by a spirobi[fluorene] core with a bromine atom attached to the 2-position. It is a white to off-white solid with a high molecular weight and exhibits unique photophysical properties due to its fused ring structure. This compound is often used in research for its potential applications in organic electronics and materials science.

About

English Name 2-Bromo-9,9'-spirobi[fluorene]
Molecular Formula C25H15Br
Molecular Weight 395.3 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)Br
InChIKey ONCCVJKFWKAZAE-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7)?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is primarily used in pharmaceutical research and o...

Compound Q&A

Is 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) safe?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) is generally considered safe when handled properly...

Compound Q&A

How should 2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) be stored?

2-Bromo-9,9'-spirobi[fluorene] (CAS: 171408-76-7) should be stored in a cool, dry, and dark place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...