Compound Q&A

What are the main uses of Diphenylphosphinic chloride (CAS: 1499-21-4)?

Answer

Diphenylphosphinic chloride
Diphenylphosphinic chloride (CAS: 1499-21-4) is primarily used in pharmaceuticals as a precursor for drug development, in industrial processes for chemical synthesis, and in research for creating phosphorus-based compounds. It also finds application in food-related industries as a stabilizer and in organic chemistry for functional group transformations, though its use in food is limited to specific regulatory-approved contexts.

About

CAS No 1499-21-4
English Name Diphenylphosphinic chloride
Molecular Formula C12H10ClOP
Molecular Weight 236.64 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl
InChIKey QPQGTZMAQRXCJW-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Diphenylphosphinic chloride (CAS: 1499-21-4)?

Diphenylphosphinic chloride (CAS: 1499-21-4) is a chemical compound with the formula C13H11ClO2P. It...

Compound Q&A

Is Diphenylphosphinic chloride (CAS: 1499-21-4) safe?

Diphenylphosphinic chloride (CAS: 1499-21-4) requires careful handling due to its potential toxicity...

Compound Q&A

How should Diphenylphosphinic chloride (CAS: 1499-21-4) be stored?

Diphenylphosphinic chloride (CAS: 1499-21-4) should be stored in a cool, dry, and dark environment t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...