Compound Q&A

What is Diphenylphosphinic chloride (CAS: 1499-21-4)?

Answer

Diphenylphosphinic chloride
Diphenylphosphinic chloride (CAS: 1499-21-4) is a chemical compound with the formula C13H11ClO2P. It is a colorless liquid and a phosphinic acid derivative, known for its reactivity and applications in organic synthesis. The compound is commonly used as an intermediate in the production of pharmaceuticals and industrial chemicals, and its unique structure makes it valuable in research settings involving phosphorus-containing molecules.

About

CAS No 1499-21-4
English Name Diphenylphosphinic chloride
Molecular Formula C12H10ClOP
Molecular Weight 236.64 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl
InChIKey QPQGTZMAQRXCJW-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Diphenylphosphinic chloride (CAS: 1499-21-4)?

Diphenylphosphinic chloride (CAS: 1499-21-4) is primarily used in pharmaceuticals as a precursor for...

Compound Q&A

Is Diphenylphosphinic chloride (CAS: 1499-21-4) safe?

Diphenylphosphinic chloride (CAS: 1499-21-4) requires careful handling due to its potential toxicity...

Compound Q&A

How should Diphenylphosphinic chloride (CAS: 1499-21-4) be stored?

Diphenylphosphinic chloride (CAS: 1499-21-4) should be stored in a cool, dry, and dark environment t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...