Compound Q&A

How should 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) be stored?

Answer

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane
1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) should be stored in a cool, dry, and well-ventilated area, away from direct light. It is typically kept in sealed, airtight containers made of materials like polyethylene to prevent contamination. Maintaining stable storage conditions is essential to preserve its chemical integrity and ensure long-term usability.

About

CAS No 69304-37-6
English Name 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane
Molecular Formula C12H28Cl2OSi2
Molecular Weight 315.43 g/mol
SMILES CC(C)[Si](C(C)C)(O[Si](C(C)C)(C(C)C)Cl)Cl
InChIKey DDYAZDRFUVZBMM-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6)?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is an organosilicon compound with th...

Compound Q&A

What are the main uses of 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6)?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is primarily used in the synthesis o...

Compound Q&A

Is 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) safe?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is generally considered safe when ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...