Compound Q&A

What are the main uses of 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6)?

Answer

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane
1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is primarily used in the synthesis of silicone compounds, including siloxanes and silanes. It finds applications in pharmaceutical research, as a solvent or stabilizer, and in industrial processes for producing specialty chemicals. Its unique structure also makes it valuable in the development of coatings and materials with specific functional properties.

About

CAS No 69304-37-6
English Name 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane
Molecular Formula C12H28Cl2OSi2
Molecular Weight 315.43 g/mol
SMILES CC(C)[Si](C(C)C)(O[Si](C(C)C)(C(C)C)Cl)Cl
InChIKey DDYAZDRFUVZBMM-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6)?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is an organosilicon compound with th...

Compound Q&A

Is 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) safe?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) is generally considered safe when ha...

Compound Q&A

How should 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) be stored?

1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane (CAS: 69304-37-6) should be stored in a cool, dry, and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...