Compound Q&A

What are the main uses of 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0)?

Answer

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate
3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) is primarily used as a green solvent in pharmaceutical and chemical synthesis. It also finds applications in catalytic reactions, electrochemistry, and material science due to its unique properties. Its use in research settings is common for its stability and low toxicity compared to traditional solvents.

About

English Name 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate
Molecular Formula C6H11F6N2P
Molecular Weight 256.13 g/mol
SMILES C[N+]1=CN(CC)C=C1.F[P-](F)(F)(F)(F)F
InChIKey DPDAKOVGQUGTHH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0)?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate is an ionic liquid with the CAS number 155371...

Compound Q&A

Is 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) safe?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) is generally considered sa...

Compound Q&A

How should 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) be stored?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...