Compound Q&A

What is 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0)?

Answer

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate
3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate is an ionic liquid with the CAS number 155371-19-0. It consists of an imidazolium cation and hexafluorophosphate anion, making it a versatile solvent and catalyst in various chemical processes. This compound is known for its thermal stability, non-volatility, and ability to dissolve a wide range of substances.

About

English Name 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate
Molecular Formula C6H11F6N2P
Molecular Weight 256.13 g/mol
SMILES C[N+]1=CN(CC)C=C1.F[P-](F)(F)(F)(F)F
InChIKey DPDAKOVGQUGTHH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0)?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) is primarily used as a gre...

Compound Q&A

Is 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) safe?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) is generally considered sa...

Compound Q&A

How should 3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) be stored?

3-Ethyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 155371-19-0) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...