Compound Q&A

What is Netilmicin sulfate (CAS: 56391-57-2)?

Answer

Netilmicin sulfate
Netilmicin sulfate is an aminoglycoside antibiotic used to treat bacterial infections. It has the chemical formula C21H42N6O12S2 and is known for its broad-spectrum activity against both Gram-negative and Gram-positive bacteria. This compound is typically white to off-white in appearance and is highly soluble in water, making it suitable for pharmaceutical formulations.

About

CAS No 56391-57-2
English Name Netilmicin sulfate
Molecular Formula C21H43N5O11S
Molecular Weight 573.66 g/mol
SMILES OS(=O)(=O)O.CCN[C@@H]1C[C@H](N)[C@H]([C@@H]([C@H]1O[C@H]1OC[C@]([C@@H]([C@H]1O)NC)(C)O)O)O[C@H]1OC(=CC[C@H]1N)CN
InChIKey PQHZSWZPVGHDEZ-UIQTUGNFSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Netilmicin sulfate (CAS: 56391-57-2)?

Netilmicin sulfate is primarily used in the treatment of severe bacterial infections such as those a...

Compound Q&A

Is Netilmicin sulfate (CAS: 56391-57-2) safe?

Netilmicin sulfate is generally considered safe when used as directed, but it can cause side effects...

Compound Q&A

How should Netilmicin sulfate (CAS: 56391-57-2) be stored?

Netilmicin sulfate should be stored in a cool, dry place away from direct light. It is typically kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...