Compound Q&A

What are the main uses of 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9)?

Answer

3,6-Dichloro-2-methoxybenzoic acid
3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is primarily used in pharmaceutical research for the development of drugs and as an intermediate in organic synthesis. It also finds applications in agrochemicals and materials science due to its versatile chemical structure and reactivity, making it relevant for chemical synthesis and industrial processes.

About

CAS No 1918-00-9
English Name 3,6-Dichloro-2-methoxybenzoic acid
Molecular Formula C8H6Cl2O3
Molecular Weight 221.04 g/mol
SMILES O=C(O)C1=C(Cl)C=CC(Cl)=C1OC
InChIKey IWEDIXLBFLAXBO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9)?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is an organic compound with the chemical formula...

Compound Q&A

Is 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) safe?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is considered hazardous when handled improperly....

Compound Q&A

How should 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) be stored?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) should be stored in a cool, dry, and dark place,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...