Compound Q&A

What is 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9)?

Answer

3,6-Dichloro-2-methoxybenzoic acid
3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is an organic compound with the chemical formula C8H6Cl2O3. It is a derivative of benzoic acid, featuring two chlorine atoms and one methoxy group at specific positions. This compound is known for its aromatic structure and is commonly used in various chemical applications due to its reactivity and functional groups.

About

CAS No 1918-00-9
English Name 3,6-Dichloro-2-methoxybenzoic acid
Molecular Formula C8H6Cl2O3
Molecular Weight 221.04 g/mol
SMILES O=C(O)C1=C(Cl)C=CC(Cl)=C1OC
InChIKey IWEDIXLBFLAXBO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9)?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is primarily used in pharmaceutical research for...

Compound Q&A

Is 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) safe?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) is considered hazardous when handled improperly....

Compound Q&A

How should 3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) be stored?

3,6-Dichloro-2-methoxybenzoic acid (CAS: 1918-00-9) should be stored in a cool, dry, and dark place,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...