Compound Q&A

What are the main uses of 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2)?

Answer

2-Bromo-4-nitro-1H-imidazole
2-Bromo-4-nitro-1H-imidazole is primarily used in pharmaceutical research as a building block for the synthesis of various bioactive compounds. It also finds applications in organic chemistry for creating derivatives with potential medicinal properties. Additionally, it is utilized in industrial processes and as a reagent in chemical research for functional group modifications.

About

CAS No 65902-59-2
English Name 2-Bromo-4-nitro-1H-imidazole
Molecular Formula C3H2BrN3O2
Molecular Weight 191.97 g/mol
SMILES C1=C(NC(=N1)Br)[N+](=O)[O-]
InChIKey UWRJWMLKEHRGOH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2)?

2-Bromo-4-nitro-1H-imidazole is a heterocyclic aromatic compound with the chemical formula C3H3BrN2O...

Compound Q&A

Is 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2) safe?

2-Bromo-4-nitro-1H-imidazole is considered hazardous due to its potential to cause skin and eye irri...

Compound Q&A

How should 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2) be stored?

2-Bromo-4-nitro-1H-imidazole should be stored in a cool, dry, and well-ventilated area away from lig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...