Compound Q&A

What is 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2)?

Answer

2-Bromo-4-nitro-1H-imidazole
2-Bromo-4-nitro-1H-imidazole is a heterocyclic aromatic compound with the chemical formula C3H3BrN2O2. It features a five-membered imidazole ring substituted with a bromine atom at the 2-position and a nitro group at the 4-position. This compound is known for its stability and reactivity in chemical reactions, making it a valuable intermediate in organic synthesis.

About

CAS No 65902-59-2
English Name 2-Bromo-4-nitro-1H-imidazole
Molecular Formula C3H2BrN3O2
Molecular Weight 191.97 g/mol
SMILES C1=C(NC(=N1)Br)[N+](=O)[O-]
InChIKey UWRJWMLKEHRGOH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2)?

2-Bromo-4-nitro-1H-imidazole is primarily used in pharmaceutical research as a building block for th...

Compound Q&A

Is 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2) safe?

2-Bromo-4-nitro-1H-imidazole is considered hazardous due to its potential to cause skin and eye irri...

Compound Q&A

How should 2-Bromo-4-nitro-1H-imidazole (CAS: 65902-59-2) be stored?

2-Bromo-4-nitro-1H-imidazole should be stored in a cool, dry, and well-ventilated area away from lig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...