Compound Q&A

How should Angoroside C (CAS: 115909-22-3) be stored?

Answer

Angoroside C
Angoroside C (CAS: 115909-22-3) should be stored in a cool, dry, and dark place, ideally at 2-8°C. Keep it in a sealed, airtight container to prevent moisture exposure and degradation. Avoid prolonged light exposure and ensure storage conditions maintain its chemical stability and potency.

About

English Name Angoroside C
Molecular Formula C36H48O19
Molecular Weight 784.7610000000005 g/mol
SMILES C[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/c3ccc(c(c3)OC)O)CO[C@H]4[C@@H]([C@H]([C@H](CO4)O)O)O)OCCc5ccc(c(c5)O)OC)O)O)O)O
InChIKey KLQXMRBGMLHBBQ-FUNGFBQYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Angoroside C (CAS: 115909-22-3)?

Angoroside C (CAS: 115909-22-3) is a natural glycoside compound derived from plants in the Asteracea...

Compound Q&A

What are the main uses of Angoroside C (CAS: 115909-22-3)?

Angoroside C (CAS: 115909-22-3) is primarily utilized in pharmaceutical research for its antioxidant...

Compound Q&A

Is Angoroside C (CAS: 115909-22-3) safe?

Angoroside C (CAS: 115909-22-3) is generally considered safe when handled properly, but limited toxi...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...