Compound Q&A

What are the main uses of Rubitecan (CAS: 91421-42-0)?

Answer

Rubitecan
Rubitecan (CAS: 91421-42-0) is mainly used in pharmaceutical research for its anticancer properties. It serves as a promising candidate in the development of new chemotherapy drugs. Additionally, it is explored for applications in medicinal chemistry and drug delivery systems due to its unique molecular structure and biological activity.

About

CAS No 91421-42-0
English Name Rubitecan
Molecular Formula C20H15N3O6
Molecular Weight 393.35 g/mol
SMILES CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=C(C=CC=C5[N+](=O)[O-])N=C4C3=C2)O
InChIKey VHXNKPBCCMUMSW-FQEVSTJZSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Rubitecan (CAS: 91421-42-0)?

Rubitecan, with the CAS number 91421-42-0, is a synthetic organic compound primarily used in pharmac...

Compound Q&A

Is Rubitecan ( CAS: 91421-42-0 ) safe?

Rubitecan (CAS: 91421-42-0) is generally considered safe when handled properly in controlled environ...

Compound Q&A

How should Rubitecan (CAS: 91421-42-0) be stored?

Rubitecan (CAS: 91421-42-0) should be stored in a cool, dry, and dark place to maintain its stabilit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...