Compound Q&A

What is Apixaban Impurity 47 (CAS: 536759-91-8)?

Answer

Apixaban Impurity 47
Apixaban Impurity 47 is a specific chemical compound identified by the CAS number 536759-91-8. It is an impurity associated with apixaban, an anticoagulant drug used in pharmaceuticals. The compound typically exhibits structural similarity to apixaban and is characterized by its chemical properties relevant to drug purity analysis.

About

English Name Apixaban Impurity 47
Molecular Formula C22H20N4O6
Molecular Weight 436.42 g/mol
SMILES O=C(C1=NN(C2=CC=C(OC)C=C2)C3=C1CCN(C4=CC=C([N+]([O-])=O)C=C4)C3=O)OCC
InChIKey RQNAOIQEGPVYTC-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Apixaban Impurity 47 (CAS: 536759-91-8)?

Apixaban Impurity 47 is primarily used in pharmaceutical research and quality control to identify an...

Compound Q&A

Is Apixaban Impurity 47 (CAS: 536759-91-8) safe?

Apixaban Impurity 47 is generally considered safe in controlled laboratory settings and at low conce...

Compound Q&A

How should Apixaban Impurity 47 (CAS: 536759-91-8) be stored?

Apixaban Impurity 47 should be stored in a cool, dry place away from light and moisture. Keep in a s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...