Compound Q&A

Is (11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6) safe?

Answer

(11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione
(11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6) is generally considered safe when handled properly in controlled laboratory settings. However, as a chemical compound, it may pose risks if exposed to skin, eyes, or inhaled. Safety precautions include wearing appropriate personal protective equipment (PPE) and following standard laboratory safety protocols to minimize potential health hazards.

About

CAS No 50-22-6
English Name (11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione
Molecular Formula C21H30O4
Molecular Weight 346.47 g/mol
SMILES OCC(=O)[C@H]1CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C
InChIKey OMFXVFTZEKFJBZ-HJTSIMOOSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6)?

(11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione, with CAS number 50-22-6, is a steroid compound class...

Compound Q&A

What are the main uses of (11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6)?

(11beta)-11,21-Dihdroxypregn-4-ene-3,20-dione (CAS: 50-22-6) is primarily used in the synthesis of c...

Compound Q&A

How should (11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6) be stored?

(11beta)-11,21-Dihydroxypregn-4-ene-3,20-dione (CAS: 50-22-6) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...