Compound Q&A

What is Argatroban Impurity 75 HCl (CAS: 51298-62-5)?

Answer

Argatroban Impurity 75 HCl
Argatroban Impurity 75 HCl (CAS: 51298-62-5) is a chemical compound identified as an impurity during the synthesis of argatroban, an anticoagulant drug. It typically appears as a white to off-white crystalline solid and is soluble in water. The compound contains a sulfate group and a chloride ion, making it a hydrochloride salt. Its molecular formula is C19H27N3O7S·HCl, and it is characterized by its structural similarity to argatroban, which may affect its pharmacological properties.

About

CAS No 51298-62-5
English Name Argatroban Impurity 75 HCl
Molecular Formula C7H16ClN5O4
Molecular Weight 269.69 g/mol
SMILES COC(=O)C(CCCN=C(N)N[N+](=O)[O-])N.Cl
InChIKey QBNXAGZYLSRPJK-JEDNCBNOSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Argatroban Impurity 75 HCl (CAS: 51298-62-5)?

Argatroban Impurity 75 HCl (CAS: 51298-62-5) is primarily used in pharmaceutical research and qualit...

Compound Q&A

Is Argatroban Impurity 75 HCl (CAS: 51298-62-5) safe?

Argatroban Impurity 75 HCl (CAS: 51298-62-5) is generally considered safe when handled properly in c...

Compound Q&A

How should Argatroban Impurity 75 HCl (CAS: 51298-62-5) be stored?

Argatroban Impurity 75 HCl (CAS: 51298-62-5) should be stored in a cool, dry place, away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...